C23H32 — CID 123329034
2-(5-but-2-enyl-4-ethylidenedeca-2,5,9-trienyl)-5-methylcyclohexa-1,3-diene (PubChem CID 123329034) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-(5-but-2-enyl-4-ethylidenedeca-2,5,9-trienyl)-5-methylcyclohexa-1,3-diene.
| Compound Name | 2-(5-but-2-enyl-4-ethylidenedeca-2,5,9-trienyl)-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123329034 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2-(5-but-2-enyl-4-ethylidenedeca-2,5,9-trienyl)-5-methylcyclohexa-1,3-diene |
| SMILES | C=CCCC=C(CC=CC)C(C=CCC1=CCC(C)C=C1)=CC |
| InChI | InChI=1S/C23H32/c1-5-8-10-14-23(13-9-6-2)22(7-3)15-11-12-21-18-16-20(4)17-19-21/h5-7,9,11,14-16,18-20H,1,8,10,12-13,17H2,2-4H3 |
| InChIKey | CPDOFQWVNYJCAG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|