About 1-cyanoethyl 1-isocyanoethyl carbonate
1-cyanoethyl 1-isocyanoethyl carbonate (PubChem CID 123329079) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 1-cyanoethyl 1-isocyanoethyl carbonate.
Molecular Properties
| Compound Name | 1-cyanoethyl 1-isocyanoethyl carbonate |
| PubChem CID | 123329079 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 1-cyanoethyl 1-isocyanoethyl carbonate |
| SMILES | [C-]#[N+]C(C)OC(=O)OC(C)C#N |
| InChI | InChI=1S/C7H8N2O3/c1-5(4-8)11-7(10)12-6(2)9-3/h5-6H,1-2H3 |
| InChIKey | WFMRMAIDLADUFK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoethyl 1-isocyanoethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethyl 1-isocyanoethyl carbonate?
The IUPAC name of 1-cyanoethyl 1-isocyanoethyl carbonate (CID 123329079) is 1-cyanoethyl 1-isocyanoethyl carbonate.
What is the SMILES notation for 1-cyanoethyl 1-isocyanoethyl carbonate?
The canonical SMILES for 1-cyanoethyl 1-isocyanoethyl carbonate is [C-]#[N+]C(C)OC(=O)OC(C)C#N.
What is the InChIKey of 1-cyanoethyl 1-isocyanoethyl carbonate?
The InChIKey is WFMRMAIDLADUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-5(4-8)11-7(10)12-6(2)9-3/h5-6H,1-2H3.
What are the key properties of 1-cyanoethyl 1-isocyanoethyl carbonate?
1-cyanoethyl 1-isocyanoethyl carbonate has a molecular weight of 168.15 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethyl 1-isocyanoethyl carbonate is sourced from PubChem (CID 123329079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).