C27H41NO3 — CID 123329421
4-(4-methoxy-3a,7a-dimethyl-1-methylidene-2,3,4,5,6,7-hexahydroinden-5-yl)-4-methyl-3-(2-pyridin-2-yloxyethyl)cyclohexan-1-ol (PubChem CID 123329421) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is 4-(4-methoxy-3a,7a-dimethyl-1-methylidene-2,3,4,5,6,7-hexahydroinden-5-yl)-4-methyl-3-(2-pyridin-2-yloxyethyl)cyclohexan-1-ol.
| Compound Name | 4-(4-methoxy-3a,7a-dimethyl-1-methylidene-2,3,4,5,6,7-hexahydroinden-5-yl)-4-methyl-3-(2-pyridin-2-yloxyethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 123329421 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | 4-(4-methoxy-3a,7a-dimethyl-1-methylidene-2,3,4,5,6,7-hexahydroinden-5-yl)-4-methyl-3-(2-pyridin-2-yloxyethyl)cyclohexan-1-ol |
| SMILES | C=C1CCC2(C)C(OC)C(C3(C)CCC(O)CC3CCOc3ccccn3)CCC12C |
| InChI | InChI=1S/C27H41NO3/c1-19-9-14-27(4)24(30-5)22(11-15-26(19,27)3)25(2)13-10-21(29)18-20(25)12-17-31-23-8-6-7-16-28-23/h6-8,16,20-22,24,29H,1,9-15,17-18H2,2-5H3 |
| InChIKey | KZCDJCAFMNCUFY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|