C31H40ClFN4O3Si — CID 123329757
4-[3-amino-6-[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide (PubChem CID 123329757) has the molecular formula C31H40ClFN4O3Si and a molecular weight of 599.22 g/mol. Its IUPAC name is 4-[3-amino-6-[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide.
| Compound Name | 4-[3-amino-6-[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 123329757 |
| Molecular Formula | C31H40ClFN4O3Si |
| Molecular Weight | 599.22 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | 4-[3-amino-6-[3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-2-fluorobenzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC(c2cnc(N)c(-c3ccc(C(=O)N[C@H](CO)c4cccc(Cl)c4)c(F)c3)n2)C1 |
| InChI | InChI=1S/C31H40ClFN4O3Si/c1-31(2,3)41(4,5)40-23-11-7-9-20(15-23)26-17-35-29(34)28(36-26)21-12-13-24(25(33)16-21)30(39)37-27(18-38)19-8-6-10-22(32)14-19/h6,8,10,12-14,16-17,20,23,27,38H,7,9,11,15,18H2,1-5H3,(H2,34,35)(H,37,39)/t20?,23?,27-/m1/s1 |
| InChIKey | AJQOMQDKXGOPOG-LTFVAXTNSA-N |
| XLogP | 7.03 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.22 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|