About N,3-dimethyl-4-penta-2,4-dienylaniline
N,3-dimethyl-4-penta-2,4-dienylaniline (PubChem CID 123329785) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is N,3-dimethyl-4-penta-2,4-dienylaniline.
Molecular Properties
| Compound Name | N,3-dimethyl-4-penta-2,4-dienylaniline |
| PubChem CID | 123329785 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N,3-dimethyl-4-penta-2,4-dienylaniline |
| SMILES | C=CC=CCc1ccc(NC)cc1C |
| InChI | InChI=1S/C13H17N/c1-4-5-6-7-12-8-9-13(14-3)10-11(12)2/h4-6,8-10,14H,1,7H2,2-3H3 |
| InChIKey | WPKXOSZVHJMFHF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-4-penta-2,4-dienylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-4-penta-2,4-dienylaniline?
The IUPAC name of N,3-dimethyl-4-penta-2,4-dienylaniline (CID 123329785) is N,3-dimethyl-4-penta-2,4-dienylaniline.
What is the SMILES notation for N,3-dimethyl-4-penta-2,4-dienylaniline?
The canonical SMILES for N,3-dimethyl-4-penta-2,4-dienylaniline is C=CC=CCc1ccc(NC)cc1C.
What is the InChIKey of N,3-dimethyl-4-penta-2,4-dienylaniline?
The InChIKey is WPKXOSZVHJMFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-4-5-6-7-12-8-9-13(14-3)10-11(12)2/h4-6,8-10,14H,1,7H2,2-3H3.
What are the key properties of N,3-dimethyl-4-penta-2,4-dienylaniline?
N,3-dimethyl-4-penta-2,4-dienylaniline has a molecular weight of 187.29 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-4-penta-2,4-dienylaniline is sourced from PubChem (CID 123329785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).