C27H25F3N6O2S — CID 123329961
5-[[2-[[4-[[2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123329961) has the molecular formula C27H25F3N6O2S and a molecular weight of 554.60 g/mol. Its IUPAC name is 5-[[2-[[4-[[2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[[4-[[2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123329961 |
| Molecular Formula | C27H25F3N6O2S |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 5-[[2-[[4-[[2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(NC3CCC(NCc4cccnc4-c4ccccc4C(F)(F)F)CC3)n2)S1 |
| InChI | InChI=1S/C27H25F3N6O2S/c28-27(29,30)21-6-2-1-5-20(21)23-16(4-3-12-31-23)15-33-17-7-9-18(10-8-17)34-25-32-13-11-19(35-25)14-22-24(37)36-26(38)39-22/h1-6,11-14,17-18,33H,7-10,15H2,(H,32,34,35)(H,36,37,38) |
| InChIKey | QKPQGMQHTHRNNQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|