C24H25F3O4S — CID 123330013
6-[1-[4-(trifluoromethyl)phenyl]sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione (PubChem CID 123330013) has the molecular formula C24H25F3O4S and a molecular weight of 466.52 g/mol. Its IUPAC name is 6-[1-[4-(trifluoromethyl)phenyl]sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione.
| Compound Name | 6-[1-[4-(trifluoromethyl)phenyl]sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 123330013 |
| Molecular Formula | C24H25F3O4S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 6-[1-[4-(trifluoromethyl)phenyl]sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C(C)CS(=O)c3ccc(C(F)(F)F)cc3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C24H25F3O4S/c1-13-9-14(2)21(15(3)10-13)22-19(28)11-20(31-23(22)29)16(4)12-32(30)18-7-5-17(6-8-18)24(25,26)27/h5-10,16,20,22H,11-12H2,1-4H3 |
| InChIKey | JPQAAAVNXCCTCT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|