C33H40N2O5 — CID 123330215
11-hydroxy-8-(2-hydroxyacetyl)-9,12,13-trimethyl-6-[(1-methylindol-3-yl)methyl]-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 123330215) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is 11-hydroxy-8-(2-hydroxyacetyl)-9,12,13-trimethyl-6-[(1-methylindol-3-yl)methyl]-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | 11-hydroxy-8-(2-hydroxyacetyl)-9,12,13-trimethyl-6-[(1-methylindol-3-yl)methyl]-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 123330215 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 11-hydroxy-8-(2-hydroxyacetyl)-9,12,13-trimethyl-6-[(1-methylindol-3-yl)methyl]-7-oxa-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | Cn1cc(CN2CC3CC4C5CCC6=CC(=O)C=CC6(C)C5(C)C(O)CC4(C)C3(C(=O)CO)O2)c2ccccc21 |
| InChI | InChI=1S/C33H40N2O5/c1-30-12-11-23(37)13-21(30)9-10-25-26-14-22-18-35(17-20-16-34(4)27-8-6-5-7-24(20)27)40-33(22,29(39)19-36)31(26,2)15-28(38)32(25,30)3/h5-8,11-13,16,22,25-26,28,36,38H,9-10,14-15,17-19H2,1-4H3 |
| InChIKey | GDGWTFBCAAQGGV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |