C24H22ClN5S — CID 123330622
2-[2-[6-chloro-4-(4-prop-2-enylpiperazin-1-yl)quinazolin-7-yl]phenyl]-1,3-thiazole (PubChem CID 123330622) has the molecular formula C24H22ClN5S and a molecular weight of 448.00 g/mol. Its IUPAC name is 2-[2-[6-chloro-4-(4-prop-2-enylpiperazin-1-yl)quinazolin-7-yl]phenyl]-1,3-thiazole.
| Compound Name | 2-[2-[6-chloro-4-(4-prop-2-enylpiperazin-1-yl)quinazolin-7-yl]phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 123330622 |
| Molecular Formula | C24H22ClN5S |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[2-[6-chloro-4-(4-prop-2-enylpiperazin-1-yl)quinazolin-7-yl]phenyl]-1,3-thiazole |
| SMILES | C=CCN1CCN(c2ncnc3cc(-c4ccccc4-c4nccs4)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C24H22ClN5S/c1-2-8-29-9-11-30(12-10-29)23-20-14-21(25)19(15-22(20)27-16-28-23)17-5-3-4-6-18(17)24-26-7-13-31-24/h2-7,13-16H,1,8-12H2 |
| InChIKey | CYHJADMQVDWIIL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|