C8H15NO6S — CID 123330652
6-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid (PubChem CID 123330652) has the molecular formula C8H15NO6S and a molecular weight of 253.28 g/mol. Its IUPAC name is 6-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid.
| Compound Name | 6-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 123330652 |
| Molecular Formula | C8H15NO6S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 6-(methylsulfonyloxymethyl)-1,4-oxazepane-4-carboxylic acid |
| SMILES | CS(=O)(=O)OCC1COCCN(C(=O)O)C1 |
| InChI | InChI=1S/C8H15NO6S/c1-16(12,13)15-6-7-4-9(8(10)11)2-3-14-5-7/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | RWTWAZHHKNGHBO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|