C31H44FNO2 — CID 123330990
6-(4-fluoro-3-hydroxyphenyl)-5-[6-[heptyl(methyl)amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 123330990) has the molecular formula C31H44FNO2 and a molecular weight of 481.70 g/mol. Its IUPAC name is 6-(4-fluoro-3-hydroxyphenyl)-5-[6-[heptyl(methyl)amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(4-fluoro-3-hydroxyphenyl)-5-[6-[heptyl(methyl)amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 123330990 |
| Molecular Formula | C31H44FNO2 |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | 6-(4-fluoro-3-hydroxyphenyl)-5-[6-[heptyl(methyl)amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CCCCCCCN(C)CCCCCCC1=C(c2ccc(F)c(O)c2)CCCc2cc(O)ccc21 |
| InChI | InChI=1S/C31H44FNO2/c1-3-4-5-7-10-20-33(2)21-11-8-6-9-14-29-27(25-16-19-30(32)31(35)23-25)15-12-13-24-22-26(34)17-18-28(24)29/h16-19,22-23,34-35H,3-15,20-21H2,1-2H3 |
| InChIKey | SYGXNWHSRPQWPC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|