C13H21NO — CID 123331060
3-(methylamino)-6-prop-1-enylnona-6,8-dien-2-one (PubChem CID 123331060) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-(methylamino)-6-prop-1-enylnona-6,8-dien-2-one.
| Compound Name | 3-(methylamino)-6-prop-1-enylnona-6,8-dien-2-one |
|---|---|
| PubChem CID | 123331060 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-(methylamino)-6-prop-1-enylnona-6,8-dien-2-one |
| SMILES | C=CC=C(C=CC)CCC(NC)C(C)=O |
| InChI | InChI=1S/C13H21NO/c1-5-7-12(8-6-2)9-10-13(14-4)11(3)15/h5-8,13-14H,1,9-10H2,2-4H3 |
| InChIKey | ZSAQBZKPVKMNQS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|