C12H21N — CID 123331318
4,4,7-trimethylnona-5,7-dien-2-imine (PubChem CID 123331318) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 4,4,7-trimethylnona-5,7-dien-2-imine.
| Compound Name | 4,4,7-trimethylnona-5,7-dien-2-imine |
|---|---|
| PubChem CID | 123331318 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4,4,7-trimethylnona-5,7-dien-2-imine |
| SMILES | [H]/N=C(\C)CC(C)(C)C=CC(C)=CC |
| InChI | InChI=1S/C12H21N/c1-6-10(2)7-8-12(4,5)9-11(3)13/h6-8,13H,9H2,1-5H3/b8-7?,10-6?,13-11+ |
| InChIKey | KMZIOSRQCGIGDV-LUPPRDANSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|