About (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate
(2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate (PubChem CID 123331349) has the molecular formula C15H24N2O7
and a molecular weight of 344.36 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate |
| PubChem CID | 123331349 |
| Molecular Formula | C15H24N2O7 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate |
| SMILES | CC(C)(CCO)OCCNC(=O)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H24N2O7/c1-15(2,7-9-18)23-10-8-16-11(19)3-6-14(22)24-17-12(20)4-5-13(17)21/h4-5,18,20-21H,3,6-10H2,1-2H3,(H,16,19) |
| InChIKey | VHRQLIKNNJNPNE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate (CID 123331349) is (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate is CC(C)(CCO)OCCNC(=O)CCC(=O)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate?
The InChIKey is VHRQLIKNNJNPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O7/c1-15(2,7-9-18)23-10-8-16-11(19)3-6-14(22)24-17-12(20)4-5-13(17)21/h4-5,18,20-21H,3,6-10H2,1-2H3,(H,16,19).
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate?
(2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate has a molecular weight of 344.36 g/mol, XLogP of -0.07, 10 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4-[2-(4-hydroxy-2-methylbutan-2-yl)oxyethylamino]-4-oxobutanoate is sourced from PubChem (CID 123331349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).