C22H27N3O — CID 123331590
2-ethenyl-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]penta-2,4-dienamide (PubChem CID 123331590) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-ethenyl-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]penta-2,4-dienamide.
| Compound Name | 2-ethenyl-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 123331590 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-ethenyl-N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]penta-2,4-dienamide |
| SMILES | C=CC=C(C=C)C(=O)NC1CCN(CCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H27N3O/c1-3-7-17(4-2)22(26)24-19-11-14-25(15-12-19)13-10-18-16-23-21-9-6-5-8-20(18)21/h3-9,16,19,23H,1-2,10-15H2,(H,24,26) |
| InChIKey | ROQLDUKHPLSLEP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|