About 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate
3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate (PubChem CID 123331597) has the molecular formula C17H34O2Si
and a molecular weight of 298.54 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate.
Molecular Properties
| Compound Name | 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate |
| PubChem CID | 123331597 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate |
| SMILES | CC1CC(C(C)C(=O)OCCC[Si](C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C17H34O2Si/c1-13-11-15(17(3,4)12-13)14(2)16(18)19-9-8-10-20(5,6)7/h13-15H,8-12H2,1-7H3 |
| InChIKey | WGVSPYINCOBPDZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate?
The IUPAC name of 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate (CID 123331597) is 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate.
What is the SMILES notation for 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate?
The canonical SMILES for 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate is CC1CC(C(C)C(=O)OCCC[Si](C)(C)C)C(C)(C)C1.
What is the InChIKey of 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate?
The InChIKey is WGVSPYINCOBPDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2Si/c1-13-11-15(17(3,4)12-13)14(2)16(18)19-9-8-10-20(5,6)7/h13-15H,8-12H2,1-7H3.
What are the key properties of 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate?
3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate has a molecular weight of 298.54 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylpropyl 2-(2,2,4-trimethylcyclopentyl)propanoate is sourced from PubChem (CID 123331597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).