About tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate
tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate (PubChem CID 123331962) has the molecular formula C13H22N4O2
and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate |
| PubChem CID | 123331962 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate |
| SMILES | C=CC(=C)CN(C(=O)OC(C)(C)C)/C(N)=N/C=N/C |
| InChI | InChI=1S/C13H22N4O2/c1-7-10(2)8-17(11(14)16-9-15-6)12(18)19-13(3,4)5/h7,9H,1-2,8H2,3-6H3,(H2,14,15,16) |
| InChIKey | KHQVIESJUQNHCC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate?
The IUPAC name of tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate (CID 123331962) is tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate.
What is the SMILES notation for tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate?
The canonical SMILES for tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate is C=CC(=C)CN(C(=O)OC(C)(C)C)/C(N)=N/C=N/C.
What is the InChIKey of tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate?
The InChIKey is KHQVIESJUQNHCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O2/c1-7-10(2)8-17(11(14)16-9-15-6)12(18)19-13(3,4)5/h7,9H,1-2,8H2,3-6H3,(H2,14,15,16).
What are the key properties of tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate?
tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate has a molecular weight of 266.34 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-methylidenebut-3-enyl)-N-[N'-(methyliminomethyl)carbamimidoyl]carbamate is sourced from PubChem (CID 123331962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).