C31H46ClN3O — CID 123332162
N-[(2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]-5-(6-ethyliminocyclohexen-1-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 123332162) has the molecular formula C31H46ClN3O and a molecular weight of 512.18 g/mol. Its IUPAC name is N-[(2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]-5-(6-ethyliminocyclohexen-1-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[(2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]-5-(6-ethyliminocyclohexen-1-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 123332162 |
| Molecular Formula | C31H46ClN3O |
| Molecular Weight | 512.18 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | N-[(2R)-1-[4-(4-chlorocyclohexa-2,4-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]-5-(6-ethyliminocyclohexen-1-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC/N=C1\CCCC=C1C1C=CCC(C(=O)N[C@@H](CN2CCC(C3C=CC(Cl)=CC3)CC2)C(C)C)C1 |
| InChI | InChI=1S/C31H46ClN3O/c1-4-33-29-11-6-5-10-28(29)25-8-7-9-26(20-25)31(36)34-30(22(2)3)21-35-18-16-24(17-19-35)23-12-14-27(32)15-13-23/h7-8,10,12,14-15,22-26,30H,4-6,9,11,13,16-21H2,1-3H3,(H,34,36)/b33-29+/t23?,25?,26?,30-/m0/s1 |
| InChIKey | FPYJETABGSVBGH-FYQVZVOSSA-N |
| XLogP | 6.69 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.18 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|