About 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide
3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide (PubChem CID 123332297) has the molecular formula C20H14Cl2N2O
and a molecular weight of 369.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide |
| PubChem CID | 123332297 |
| Molecular Formula | C20H14Cl2N2O |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide |
| SMILES | Cc1ccc2c(c1)[nH]c1c(C(N)=O)cc(-c3ccc(Cl)c(Cl)c3)cc12 |
| InChI | InChI=1S/C20H14Cl2N2O/c1-10-2-4-13-14-7-12(11-3-5-16(21)17(22)9-11)8-15(20(23)25)19(14)24-18(13)6-10/h2-9,24H,1H3,(H2,23,25) |
| InChIKey | VFRWLYJJECTNEH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide?
The IUPAC name of 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide (CID 123332297) is 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide?
The canonical SMILES for 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide is Cc1ccc2c(c1)[nH]c1c(C(N)=O)cc(-c3ccc(Cl)c(Cl)c3)cc12.
What is the InChIKey of 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide?
The InChIKey is VFRWLYJJECTNEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2O/c1-10-2-4-13-14-7-12(11-3-5-16(21)17(22)9-11)8-15(20(23)25)19(14)24-18(13)6-10/h2-9,24H,1H3,(H2,23,25).
What are the key properties of 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide?
3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide has a molecular weight of 369.25 g/mol, XLogP of 5.70, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-7-methyl-9H-carbazole-1-carboxamide is sourced from PubChem (CID 123332297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).