C25H48O3 — CID 123332462
4-ethyl-2,2,4,6-tetramethyl-6-(2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)oxyheptan-3-one (PubChem CID 123332462) has the molecular formula C25H48O3 and a molecular weight of 396.66 g/mol. Its IUPAC name is 4-ethyl-2,2,4,6-tetramethyl-6-(2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)oxyheptan-3-one.
| Compound Name | 4-ethyl-2,2,4,6-tetramethyl-6-(2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)oxyheptan-3-one |
|---|---|
| PubChem CID | 123332462 |
| Molecular Formula | C25H48O3 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.36 |
| IUPAC Name | 4-ethyl-2,2,4,6-tetramethyl-6-(2,4,4,6,6-pentamethyl-3-oxoheptan-2-yl)oxyheptan-3-one |
| SMILES | CCC(C)(CC(C)(C)OC(C)(C)C(=O)C(C)(C)CC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C25H48O3/c1-15-25(14,18(26)21(5,6)7)17-23(10,11)28-24(12,13)19(27)22(8,9)16-20(2,3)4/h15-17H2,1-14H3 |
| InChIKey | IXHQKIQNOZIAGJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |