C12H20I2O10 — CID 123333010
(2S,3S,4S,5S,6S)-6-(iodomethyl)-2-[(2R,3S,4S,5S,6S)-2,3,4,5-tetrahydroxy-6-(iodomethyl)oxan-2-yl]oxane-2,3,4,5-tetrol (PubChem CID 123333010) has the molecular formula C12H20I2O10 and a molecular weight of 578.09 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-6-(iodomethyl)-2-[(2R,3S,4S,5S,6S)-2,3,4,5-tetrahydroxy-6-(iodomethyl)oxan-2-yl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6S)-6-(iodomethyl)-2-[(2R,3S,4S,5S,6S)-2,3,4,5-tetrahydroxy-6-(iodomethyl)oxan-2-yl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 123333010 |
| Molecular Formula | C12H20I2O10 |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.91 |
| IUPAC Name | (2S,3S,4S,5S,6S)-6-(iodomethyl)-2-[(2R,3S,4S,5S,6S)-2,3,4,5-tetrahydroxy-6-(iodomethyl)oxan-2-yl]oxane-2,3,4,5-tetrol |
| SMILES | O[C@H]1[C@H](O)[C@H](O)[C@@](O)([C@]2(O)O[C@H](CI)[C@@H](O)[C@H](O)[C@@H]2O)O[C@@H]1CI |
| InChI | InChI=1S/C12H20I2O10/c13-1-3-5(15)7(17)9(19)11(21,23-3)12(22)10(20)8(18)6(16)4(2-14)24-12/h3-10,15-22H,1-2H2/t3-,4-,5-,6-,7+,8+,9+,10+,11-,12+/m1/s1 |
| InChIKey | FUGJBSGASSBEGP-CMQCSPFPSA-N |
| XLogP | -3.80 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|