About 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one
3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one (PubChem CID 123333186) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one |
| PubChem CID | 123333186 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one |
| SMILES | C/C=C\C1=NC(=O)N(C)CC1C |
| InChI | InChI=1S/C9H14N2O/c1-4-5-8-7(2)6-11(3)9(12)10-8/h4-5,7H,6H2,1-3H3/b5-4- |
| InChIKey | YVWRUIBFJRZMPJ-PLNGDYQASA-N |
| XLogP | 1.71 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one?
The IUPAC name of 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one (CID 123333186) is 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one.
What is the SMILES notation for 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one?
The canonical SMILES for 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one is C/C=C\C1=NC(=O)N(C)CC1C.
What is the InChIKey of 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one?
The InChIKey is YVWRUIBFJRZMPJ-PLNGDYQASA-N. The full InChI is InChI=1S/C9H14N2O/c1-4-5-8-7(2)6-11(3)9(12)10-8/h4-5,7H,6H2,1-3H3/b5-4-.
What are the key properties of 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one?
3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one has a molecular weight of 166.22 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydropyrimidin-2-one is sourced from PubChem (CID 123333186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).