About 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine
2-fluoro-N'-propylideneprop-2-ene-1,3-diimine (PubChem CID 123333938) has the molecular formula C6H9FN2
and a molecular weight of 128.15 g/mol. Its IUPAC name is 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine.
Molecular Properties
| Compound Name | 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine |
| PubChem CID | 123333938 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C(F)=C/N=C/CC |
| InChI | InChI=1S/C6H9FN2/c1-2-3-9-5-6(7)4-8/h3-5,8H,2H2,1H3/b6-5?,8-4+,9-3+ |
| InChIKey | QHUQLINLZXFAER-KUBHCIPGSA-N |
| XLogP | 1.93 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine?
The IUPAC name of 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine (CID 123333938) is 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine.
What is the SMILES notation for 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine?
The canonical SMILES for 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine is [H]/N=C/C(F)=C/N=C/CC.
What is the InChIKey of 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine?
The InChIKey is QHUQLINLZXFAER-KUBHCIPGSA-N. The full InChI is InChI=1S/C6H9FN2/c1-2-3-9-5-6(7)4-8/h3-5,8H,2H2,1H3/b6-5?,8-4+,9-3+.
What are the key properties of 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine?
2-fluoro-N'-propylideneprop-2-ene-1,3-diimine has a molecular weight of 128.15 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-propylideneprop-2-ene-1,3-diimine is sourced from PubChem (CID 123333938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).