About 3-methyl-3,4-dihydro-2,1-benzoxazepine
3-methyl-3,4-dihydro-2,1-benzoxazepine (PubChem CID 123333944) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-2,1-benzoxazepine.
Molecular Properties
| Compound Name | 3-methyl-3,4-dihydro-2,1-benzoxazepine |
| PubChem CID | 123333944 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-methyl-3,4-dihydro-2,1-benzoxazepine |
| SMILES | CC1CC=c2ccccc2=NO1 |
| InChI | InChI=1S/C10H11NO/c1-8-6-7-9-4-2-3-5-10(9)11-12-8/h2-5,7-8H,6H2,1H3 |
| InChIKey | DHBPLBJAANNNGZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3,4-dihydro-2,1-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,4-dihydro-2,1-benzoxazepine?
The IUPAC name of 3-methyl-3,4-dihydro-2,1-benzoxazepine (CID 123333944) is 3-methyl-3,4-dihydro-2,1-benzoxazepine.
What is the SMILES notation for 3-methyl-3,4-dihydro-2,1-benzoxazepine?
The canonical SMILES for 3-methyl-3,4-dihydro-2,1-benzoxazepine is CC1CC=c2ccccc2=NO1.
What is the InChIKey of 3-methyl-3,4-dihydro-2,1-benzoxazepine?
The InChIKey is DHBPLBJAANNNGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-8-6-7-9-4-2-3-5-10(9)11-12-8/h2-5,7-8H,6H2,1H3.
What are the key properties of 3-methyl-3,4-dihydro-2,1-benzoxazepine?
3-methyl-3,4-dihydro-2,1-benzoxazepine has a molecular weight of 161.20 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,4-dihydro-2,1-benzoxazepine is sourced from PubChem (CID 123333944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).