C17H24O3 — CID 123334054
2,3,9,9a-tetramethyl-2,3,4,4a,5,8a,9,10a-octahydroxanthene-1,8-dione (PubChem CID 123334054) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,3,9,9a-tetramethyl-2,3,4,4a,5,8a,9,10a-octahydroxanthene-1,8-dione.
| Compound Name | 2,3,9,9a-tetramethyl-2,3,4,4a,5,8a,9,10a-octahydroxanthene-1,8-dione |
|---|---|
| PubChem CID | 123334054 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2,3,9,9a-tetramethyl-2,3,4,4a,5,8a,9,10a-octahydroxanthene-1,8-dione |
| SMILES | CC1CC2OC3CC=CC(=O)C3C(C)C2(C)C(=O)C1C |
| InChI | InChI=1S/C17H24O3/c1-9-8-14-17(4,16(19)10(9)2)11(3)15-12(18)6-5-7-13(15)20-14/h5-6,9-11,13-15H,7-8H2,1-4H3 |
| InChIKey | PLWLRRUTYSAQRY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |