C29H37N5O2 — CID 123334063
2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]-7-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 123334063) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]-7-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]-7-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 123334063 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 2-[(7E,9Z)-10-ethyl-2-methyl-3,4,5,6-tetrahydrocycloocta[b]pyridin-8-yl]-7-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC/C1=C/C(c2cc(=O)n3cc(N4CCN(CCO)C(C)C4)ccc3n2)=C\CCC2=C1N=C(C)CC2 |
| InChI | InChI=1S/C29H37N5O2/c1-4-22-16-24(7-5-6-23-9-8-20(2)30-29(22)23)26-17-28(36)34-19-25(10-11-27(34)31-26)33-13-12-32(14-15-35)21(3)18-33/h7,10-11,16-17,19,21,35H,4-6,8-9,12-15,18H2,1-3H3/b22-16-,24-7+ |
| InChIKey | WCFFZCJLFPKSFD-WKHPUKHXSA-N |
| XLogP | 4.22 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |