C25H21F6N5OS — CID 123334709
2-[(3R)-3-aminopiperidin-1-yl]-5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-1,3-thiazol-4-ol (PubChem CID 123334709) has the molecular formula C25H21F6N5OS and a molecular weight of 553.53 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-1,3-thiazol-4-ol.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 123334709 |
| Molecular Formula | C25H21F6N5OS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-[2-[2,4-bis(trifluoromethyl)phenyl]-1-(1H-indazol-5-yl)ethenyl]-1,3-thiazol-4-ol |
| SMILES | N[C@@H]1CCCN(c2nc(O)c(C(=Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c3ccc4[nH]ncc4c3)s2)C1 |
| InChI | InChI=1S/C25H21F6N5OS/c26-24(27,28)16-5-3-14(19(10-16)25(29,30)31)9-18(13-4-6-20-15(8-13)11-33-35-20)21-22(37)34-23(38-21)36-7-1-2-17(32)12-36/h3-6,8-11,17,37H,1-2,7,12,32H2,(H,33,35)/t17-/m1/s1 |
| InChIKey | ILMPIVCJJJDAOX-QGZVFWFLSA-N |
| XLogP | 6.28 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|