C21H27N3 — CID 123335021
4-cyclohexa-1,3-dien-1-yl-N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(methylideneamino)cyclohex-3-ene-1-carboximidamide (PubChem CID 123335021) has the molecular formula C21H27N3 and a molecular weight of 321.47 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(methylideneamino)cyclohex-3-ene-1-carboximidamide.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(methylideneamino)cyclohex-3-ene-1-carboximidamide |
|---|---|
| PubChem CID | 123335021 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-N-hexa-1,3,5-trien-2-yl-N-methyl-N'-(methylideneamino)cyclohex-3-ene-1-carboximidamide |
| SMILES | C=CC=CC(=C)N(C)/C(=N/N=C)C1CC=C(C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C21H27N3/c1-5-6-10-17(2)24(4)21(23-22-3)20-15-13-19(14-16-20)18-11-8-7-9-12-18/h5-8,10-11,13,20H,1-3,9,12,14-16H2,4H3/b10-6?,23-21+ |
| InChIKey | ONOLDUQCVKDSPD-WNLKWHBXSA-N |
| XLogP | 5.19 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|