C12H16N2O3 — CID 123335200
ethane;ethyl 4-oxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate (PubChem CID 123335200) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethane;ethyl 4-oxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate.
| Compound Name | ethane;ethyl 4-oxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 123335200 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethane;ethyl 4-oxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate |
| SMILES | CC.CCOC(=O)c1c[nH]n2cccc2c1=O |
| InChI | InChI=1S/C10H10N2O3.C2H6/c1-2-15-10(14)7-6-11-12-5-3-4-8(12)9(7)13;1-2/h3-6,11H,2H2,1H3;1-2H3 |
| InChIKey | OBYFWFNCPBQXGP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |