C17H32Si — CID 123335306
(2,8-dimethyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-dimethylsilane (PubChem CID 123335306) has the molecular formula C17H32Si and a molecular weight of 264.53 g/mol. Its IUPAC name is (2,8-dimethyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-dimethylsilane.
| Compound Name | (2,8-dimethyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-dimethylsilane |
|---|---|
| PubChem CID | 123335306 |
| Molecular Formula | C17H32Si |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (2,8-dimethyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-dimethylsilane |
| SMILES | CC1CCC2CCC3C(CC(C)C3[SiH](C)C)C2C1 |
| InChI | InChI=1S/C17H32Si/c1-11-5-6-13-7-8-14-16(15(13)9-11)10-12(2)17(14)18(3)4/h11-18H,5-10H2,1-4H3 |
| InChIKey | WZFQZUBXVJSQMA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|