C18H19Cl2N8+ — CID 123335424
4-N-[6-(5,6-dichloro-3H-benzimidazol-1-ium-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine (PubChem CID 123335424) has the molecular formula C18H19Cl2N8+ and a molecular weight of 418.31 g/mol. Its IUPAC name is 4-N-[6-(5,6-dichloro-3H-benzimidazol-1-ium-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[6-(5,6-dichloro-3H-benzimidazol-1-ium-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123335424 |
| Molecular Formula | C18H19Cl2N8+ |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-N-[6-(5,6-dichloro-3H-benzimidazol-1-ium-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2nc(-[n+]3c[nH]c4cc(Cl)c(Cl)cc43)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C18H18Cl2N8/c19-11-5-13-14(6-12(11)20)28(8-24-13)17-15-16(23-7-22-15)26-18(27-17)25-10-3-1-9(21)2-4-10/h5-10H,1-4,21H2,(H2,22,23,25,26,27)/p+1 |
| InChIKey | KCCHPUSEDTVFHC-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|