C24H33F3N3O3+ — CID 123335648
[1-[1-acetyl-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-6-yl]-3-(trifluoromethyl)pentyl]-methyl-methylideneazanium (PubChem CID 123335648) has the molecular formula C24H33F3N3O3+ and a molecular weight of 468.54 g/mol. Its IUPAC name is [1-[1-acetyl-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-6-yl]-3-(trifluoromethyl)pentyl]-methyl-methylideneazanium.
| Compound Name | [1-[1-acetyl-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-6-yl]-3-(trifluoromethyl)pentyl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123335648 |
| Molecular Formula | C24H33F3N3O3+ |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [1-[1-acetyl-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-6-yl]-3-(trifluoromethyl)pentyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)C(CC(CC)C(F)(F)F)c1ccc2c(c1)N(C(=O)C1CCCO1)CC(C)N2C(C)=O |
| InChI | InChI=1S/C24H33F3N3O3/c1-6-18(24(25,26)27)13-20(28(4)5)17-9-10-19-21(12-17)29(14-15(2)30(19)16(3)31)23(32)22-8-7-11-33-22/h9-10,12,15,18,20,22H,4,6-8,11,13-14H2,1-3,5H3/q+1 |
| InChIKey | JIYPZSVCVDBNJV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|