C17H22ClF2N5O — CID 123335678
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3-difluorobutylamino)-N-ethylpropanamide (PubChem CID 123335678) has the molecular formula C17H22ClF2N5O and a molecular weight of 385.85 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3-difluorobutylamino)-N-ethylpropanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3-difluorobutylamino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 123335678 |
| Molecular Formula | C17H22ClF2N5O |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3-difluorobutylamino)-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCNCCC(C)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H22ClF2N5O/c1-3-24(15(26)6-9-21-10-7-17(2,19)20)14-12-25(23-16(14)18)13-5-4-8-22-11-13/h4-5,8,11-12,21H,3,6-7,9-10H2,1-2H3 |
| InChIKey | DZNCIFGZLUZFSW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|