C10H12N2O2 — CID 123335704
3,6-dimethyl-6,7-dihydro-1H-quinazoline-2,4-dione (PubChem CID 123335704) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,6-dimethyl-6,7-dihydro-1H-quinazoline-2,4-dione.
| Compound Name | 3,6-dimethyl-6,7-dihydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 123335704 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,6-dimethyl-6,7-dihydro-1H-quinazoline-2,4-dione |
| SMILES | CC1C=c2c([nH]c(=O)n(C)c2=O)=CC1 |
| InChI | InChI=1S/C10H12N2O2/c1-6-3-4-8-7(5-6)9(13)12(2)10(14)11-8/h4-6H,3H2,1-2H3,(H,11,14) |
| InChIKey | SQDFHPASXBDVFD-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |