C12H28N4O — CID 123336005
1-(2-amino-2,5-dimethylhexan-3-yl)-3-(2-aminopropan-2-yl)urea (PubChem CID 123336005) has the molecular formula C12H28N4O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(2-amino-2,5-dimethylhexan-3-yl)-3-(2-aminopropan-2-yl)urea.
| Compound Name | 1-(2-amino-2,5-dimethylhexan-3-yl)-3-(2-aminopropan-2-yl)urea |
|---|---|
| PubChem CID | 123336005 |
| Molecular Formula | C12H28N4O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 1-(2-amino-2,5-dimethylhexan-3-yl)-3-(2-aminopropan-2-yl)urea |
| SMILES | CC(C)CC(NC(=O)NC(C)(C)N)C(C)(C)N |
| InChI | InChI=1S/C12H28N4O/c1-8(2)7-9(11(3,4)13)15-10(17)16-12(5,6)14/h8-9H,7,13-14H2,1-6H3,(H2,15,16,17) |
| InChIKey | AEKFDBCOPANSFL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|