C17H28O7S — CID 123336111
2-(1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl)ethyl methanesulfonate (PubChem CID 123336111) has the molecular formula C17H28O7S and a molecular weight of 376.47 g/mol. Its IUPAC name is 2-(1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl)ethyl methanesulfonate.
| Compound Name | 2-(1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 123336111 |
| Molecular Formula | C17H28O7S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl)ethyl methanesulfonate |
| SMILES | CC1C(CCOS(C)(=O)=O)OC2OC3(C)CCC4CCCC1C42OO3 |
| InChI | InChI=1S/C17H28O7S/c1-11-13-6-4-5-12-7-9-16(2)22-15(17(12,13)24-23-16)21-14(11)8-10-20-25(3,18)19/h11-15H,4-10H2,1-3H3 |
| InChIKey | WBNBSJJLIWIJRN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|