About N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine
N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine (PubChem CID 123336504) has the molecular formula C11H21N3Si
and a molecular weight of 223.40 g/mol. Its IUPAC name is N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine.
Molecular Properties
| Compound Name | N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine |
| PubChem CID | 123336504 |
| Molecular Formula | C11H21N3Si |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine |
| SMILES | CCNC(NCC)N([SiH3])c1ccccc1 |
| InChI | InChI=1S/C11H21N3Si/c1-3-12-11(13-4-2)14(15)10-8-6-5-7-9-10/h5-9,11-13H,3-4H2,1-2,15H3 |
| InChIKey | HVENWCHQQALMQF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine?
The IUPAC name of N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine (CID 123336504) is N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine.
What is the SMILES notation for N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine?
The canonical SMILES for N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine is CCNC(NCC)N([SiH3])c1ccccc1.
What is the InChIKey of N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine?
The InChIKey is HVENWCHQQALMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3Si/c1-3-12-11(13-4-2)14(15)10-8-6-5-7-9-10/h5-9,11-13H,3-4H2,1-2,15H3.
What are the key properties of N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine?
N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine has a molecular weight of 223.40 g/mol, XLogP of 0.28, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diethyl-N"-phenyl-N"-silylmethanetriamine is sourced from PubChem (CID 123336504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).