C19H13F6N5O2 — CID 123336578
3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enamide (PubChem CID 123336578) has the molecular formula C19H13F6N5O2 and a molecular weight of 457.33 g/mol. Its IUPAC name is 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enamide.
| Compound Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 123336578 |
| Molecular Formula | C19H13F6N5O2 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(6-methoxy-3-pyridinyl)prop-2-enamide |
| SMILES | COc1ccc(C(=Cn2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C(N)=O)cn1 |
| InChI | InChI=1S/C19H13F6N5O2/c1-32-15-3-2-10(7-27-15)14(16(26)31)8-30-9-28-17(29-30)11-4-12(18(20,21)22)6-13(5-11)19(23,24)25/h2-9H,1H3,(H2,26,31) |
| InChIKey | IJPSWJGNTYDPSW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|