C33H11F20N3 — CID 123336608
2-N,2-N,6-N,6-N-tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]pyridine-2,6-diamine (PubChem CID 123336608) has the molecular formula C33H11F20N3 and a molecular weight of 829.43 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N-tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]pyridine-2,6-diamine.
| Compound Name | 2-N,2-N,6-N,6-N-tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 123336608 |
| Molecular Formula | C33H11F20N3 |
| Molecular Weight | 829.43 g/mol |
| Exact Mass | 829.06 |
| IUPAC Name | 2-N,2-N,6-N,6-N-tetrakis[(2,3,4,5,6-pentafluorophenyl)methyl]pyridine-2,6-diamine |
| SMILES | Fc1c(F)c(F)c(CN(Cc2c(F)c(F)c(F)c(F)c2F)c2cccc(N(Cc3c(F)c(F)c(F)c(F)c3F)Cc3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C33H11F20N3/c34-14-8(15(35)23(43)30(50)22(14)42)4-55(5-9-16(36)24(44)31(51)25(45)17(9)37)12-2-1-3-13(54-12)56(6-10-18(38)26(46)32(52)27(47)19(10)39)7-11-20(40)28(48)33(53)29(49)21(11)41/h1-3H,4-7H2 |
| InChIKey | HTFJLLBBBQQQBO-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.43 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|