C37H43F2NO3 — CID 123337111
5-[11-[2-(4-ethenyl-1,4-difluorocyclohexyl)ethyl]-5-methyl-3-(2,4,5-trimethylfuran-3-yl)-9-bicyclo[6.5.0]trideca-1(8),2,4,9-tetraenyl]pyridine-2-carboxylic acid (PubChem CID 123337111) has the molecular formula C37H43F2NO3 and a molecular weight of 587.75 g/mol. Its IUPAC name is 5-[11-[2-(4-ethenyl-1,4-difluorocyclohexyl)ethyl]-5-methyl-3-(2,4,5-trimethylfuran-3-yl)-9-bicyclo[6.5.0]trideca-1(8),2,4,9-tetraenyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[11-[2-(4-ethenyl-1,4-difluorocyclohexyl)ethyl]-5-methyl-3-(2,4,5-trimethylfuran-3-yl)-9-bicyclo[6.5.0]trideca-1(8),2,4,9-tetraenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 123337111 |
| Molecular Formula | C37H43F2NO3 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 5-[11-[2-(4-ethenyl-1,4-difluorocyclohexyl)ethyl]-5-methyl-3-(2,4,5-trimethylfuran-3-yl)-9-bicyclo[6.5.0]trideca-1(8),2,4,9-tetraenyl]pyridine-2-carboxylic acid |
| SMILES | C=CC1(F)CCC(F)(CCC2C=C(c3ccc(C(=O)O)nc3)C3=C(C=C(c4c(C)oc(C)c4C)C=C(C)CC3)CC2)CC1 |
| InChI | InChI=1S/C37H43F2NO3/c1-6-36(38)15-17-37(39,18-16-36)14-13-27-8-9-28-21-30(34-24(3)25(4)43-26(34)5)19-23(2)7-11-31(28)32(20-27)29-10-12-33(35(41)42)40-22-29/h6,10,12,19-22,27H,1,7-9,11,13-18H2,2-5H3,(H,41,42) |
| InChIKey | PKAVVDAYJNWHDD-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|