About pent-4-en-2-imine
pent-4-en-2-imine (PubChem CID 123337218) has the molecular formula C5H9N
and a molecular weight of 83.13 g/mol. Its IUPAC name is pent-4-en-2-imine.
Molecular Properties
| Compound Name | pent-4-en-2-imine |
| PubChem CID | 123337218 |
| Molecular Formula | C5H9N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | pent-4-en-2-imine |
| SMILES | [H]/N=C(\C)CC=C |
| InChI | InChI=1S/C5H9N/c1-3-4-5(2)6/h3,6H,1,4H2,2H3/b6-5+ |
| InChIKey | XTBPHWZBBPQMCS-AATRIKPKSA-N |
| XLogP | 1.60 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-en-2-imine?
The IUPAC name of pent-4-en-2-imine (CID 123337218) is pent-4-en-2-imine.
What is the SMILES notation for pent-4-en-2-imine?
The canonical SMILES for pent-4-en-2-imine is [H]/N=C(\C)CC=C.
What is the InChIKey of pent-4-en-2-imine?
The InChIKey is XTBPHWZBBPQMCS-AATRIKPKSA-N. The full InChI is InChI=1S/C5H9N/c1-3-4-5(2)6/h3,6H,1,4H2,2H3/b6-5+.
What are the key properties of pent-4-en-2-imine?
pent-4-en-2-imine has a molecular weight of 83.13 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-en-2-imine is sourced from PubChem (CID 123337218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).