C25H42O5 — CID 123337322
(3R,4S,5S,7R,11R,12R)-12-ethyl-3,5,7,11-tetramethyl-4-[(2S,3R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclododec-9-ene-2,8-dione (PubChem CID 123337322) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is (3R,4S,5S,7R,11R,12R)-12-ethyl-3,5,7,11-tetramethyl-4-[(2S,3R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclododec-9-ene-2,8-dione.
| Compound Name | (3R,4S,5S,7R,11R,12R)-12-ethyl-3,5,7,11-tetramethyl-4-[(2S,3R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclododec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 123337322 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (3R,4S,5S,7R,11R,12R)-12-ethyl-3,5,7,11-tetramethyl-4-[(2S,3R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclododec-9-ene-2,8-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@@H]2OC(C)CC(C)[C@H]2C)[C@@H](C)C[C@@H](C)C(=O)C=C[C@H]1C |
| InChI | InChI=1S/C25H42O5/c1-9-22-14(2)10-11-21(26)16(4)12-17(5)23(20(8)24(27)29-22)30-25-19(7)15(3)13-18(6)28-25/h10-11,14-20,22-23,25H,9,12-13H2,1-8H3/t14-,15?,16-,17+,18?,19-,20-,22-,23+,25+/m1/s1 |
| InChIKey | QNKBAVKGXIAFQY-XJBHVGBXSA-N |
| XLogP | 5.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |