C28H46O4S — CID 123337609
1-[1-[3-(2-methylhepta-1,3-dien-3-ylsulfonyl)propoxy]ethoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene (PubChem CID 123337609) has the molecular formula C28H46O4S and a molecular weight of 478.74 g/mol. Its IUPAC name is 1-[1-[3-(2-methylhepta-1,3-dien-3-ylsulfonyl)propoxy]ethoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene.
| Compound Name | 1-[1-[3-(2-methylhepta-1,3-dien-3-ylsulfonyl)propoxy]ethoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123337609 |
| Molecular Formula | C28H46O4S |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 1-[1-[3-(2-methylhepta-1,3-dien-3-ylsulfonyl)propoxy]ethoxy]-4-(2,2,5-trimethylhexan-3-yl)benzene |
| SMILES | C=C(C)C(=CCCC)S(=O)(=O)CCCOC(C)Oc1ccc(C(CC(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H46O4S/c1-10-11-13-27(22(4)5)33(29,30)19-12-18-31-23(6)32-25-16-14-24(15-17-25)26(20-21(2)3)28(7,8)9/h13-17,21,23,26H,4,10-12,18-20H2,1-3,5-9H3 |
| InChIKey | AFTSZKMXFGVSEA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|