About 1-dipropoxysilyl-N,N-dimethylmethanamine
1-dipropoxysilyl-N,N-dimethylmethanamine (PubChem CID 123337683) has the molecular formula C9H23NO2Si
and a molecular weight of 205.37 g/mol. Its IUPAC name is 1-dipropoxysilyl-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-dipropoxysilyl-N,N-dimethylmethanamine |
| PubChem CID | 123337683 |
| Molecular Formula | C9H23NO2Si |
| Molecular Weight | 205.37 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-dipropoxysilyl-N,N-dimethylmethanamine |
| SMILES | CCCO[SiH](CN(C)C)OCCC |
| InChI | InChI=1S/C9H23NO2Si/c1-5-7-11-13(9-10(3)4)12-8-6-2/h13H,5-9H2,1-4H3 |
| InChIKey | GEXZWKVBFONBJP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-dipropoxysilyl-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dipropoxysilyl-N,N-dimethylmethanamine?
The IUPAC name of 1-dipropoxysilyl-N,N-dimethylmethanamine (CID 123337683) is 1-dipropoxysilyl-N,N-dimethylmethanamine.
What is the SMILES notation for 1-dipropoxysilyl-N,N-dimethylmethanamine?
The canonical SMILES for 1-dipropoxysilyl-N,N-dimethylmethanamine is CCCO[SiH](CN(C)C)OCCC.
What is the InChIKey of 1-dipropoxysilyl-N,N-dimethylmethanamine?
The InChIKey is GEXZWKVBFONBJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO2Si/c1-5-7-11-13(9-10(3)4)12-8-6-2/h13H,5-9H2,1-4H3.
What are the key properties of 1-dipropoxysilyl-N,N-dimethylmethanamine?
1-dipropoxysilyl-N,N-dimethylmethanamine has a molecular weight of 205.37 g/mol, XLogP of 1.16, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dipropoxysilyl-N,N-dimethylmethanamine is sourced from PubChem (CID 123337683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).