C11H13ClF5N3 — CID 123337920
4-chloro-2-N-methyl-5-[(2,2,3,3,3-pentafluoropropylamino)methyl]benzene-1,2-diamine (PubChem CID 123337920) has the molecular formula C11H13ClF5N3 and a molecular weight of 317.69 g/mol. Its IUPAC name is 4-chloro-2-N-methyl-5-[(2,2,3,3,3-pentafluoropropylamino)methyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-methyl-5-[(2,2,3,3,3-pentafluoropropylamino)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 123337920 |
| Molecular Formula | C11H13ClF5N3 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-chloro-2-N-methyl-5-[(2,2,3,3,3-pentafluoropropylamino)methyl]benzene-1,2-diamine |
| SMILES | CNc1cc(Cl)c(CNCC(F)(F)C(F)(F)F)cc1N |
| InChI | InChI=1S/C11H13ClF5N3/c1-19-9-3-7(12)6(2-8(9)18)4-20-5-10(13,14)11(15,16)17/h2-3,19-20H,4-5,18H2,1H3 |
| InChIKey | KLYRTSXMPQEFRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|