C9H12N2O — CID 123338280
(4E,5E)-4,5-di(ethylidene)-3-methyl-1H-pyridazin-6-one (PubChem CID 123338280) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-3-methyl-1H-pyridazin-6-one.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-3-methyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 123338280 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-3-methyl-1H-pyridazin-6-one |
| SMILES | C/C=c1/c(C)n[nH]c(=O)/c1=C/C |
| InChI | InChI=1S/C9H12N2O/c1-4-7-6(3)10-11-9(12)8(7)5-2/h4-5H,1-3H3,(H,11,12)/b7-4-,8-5+ |
| InChIKey | OZTPOOQBHUZFIW-DKBJKEKUSA-N |
| XLogP | -0.32 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |