About propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate
propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate (PubChem CID 123338324) has the molecular formula C8H14F2O3S
and a molecular weight of 228.26 g/mol. Its IUPAC name is propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate |
| PubChem CID | 123338324 |
| Molecular Formula | C8H14F2O3S |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate |
| SMILES | CC(C)OC(=O)CS(=O)CCC(F)F |
| InChI | InChI=1S/C8H14F2O3S/c1-6(2)13-8(11)5-14(12)4-3-7(9)10/h6-7H,3-5H2,1-2H3 |
| InChIKey | HLSNFDICGIVHHI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate?
The IUPAC name of propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate (CID 123338324) is propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate.
What is the SMILES notation for propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate?
The canonical SMILES for propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate is CC(C)OC(=O)CS(=O)CCC(F)F.
What is the InChIKey of propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate?
The InChIKey is HLSNFDICGIVHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2O3S/c1-6(2)13-8(11)5-14(12)4-3-7(9)10/h6-7H,3-5H2,1-2H3.
What are the key properties of propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate?
propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate has a molecular weight of 228.26 g/mol, XLogP of 1.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(3,3-difluoropropylsulfinyl)acetate is sourced from PubChem (CID 123338324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).