About 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea
1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea (PubChem CID 123338551) has the molecular formula C8H14F2N2O
and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea |
| PubChem CID | 123338551 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CC1(C)CC1(F)F |
| InChI | InChI=1S/C8H14F2N2O/c1-7(4-8(7,9)10)5-12(3)6(13)11-2/h4-5H2,1-3H3,(H,11,13) |
| InChIKey | ZYUPZSRUCRCWGS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea?
The IUPAC name of 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea (CID 123338551) is 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea.
What is the SMILES notation for 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea?
The canonical SMILES for 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea is CNC(=O)N(C)CC1(C)CC1(F)F.
What is the InChIKey of 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea?
The InChIKey is ZYUPZSRUCRCWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O/c1-7(4-8(7,9)10)5-12(3)6(13)11-2/h4-5H2,1-3H3,(H,11,13).
What are the key properties of 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea?
1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea has a molecular weight of 192.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-difluoro-1-methylcyclopropyl)methyl]-1,3-dimethylurea is sourced from PubChem (CID 123338551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).