C24H37N3O2 — CID 123339088
[2-(3-cyclononyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-cyclooct-4-en-1-ylmethanone (PubChem CID 123339088) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is [2-(3-cyclononyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-cyclooct-4-en-1-ylmethanone.
| Compound Name | [2-(3-cyclononyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-cyclooct-4-en-1-ylmethanone |
|---|---|
| PubChem CID | 123339088 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | [2-(3-cyclononyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-cyclooct-4-en-1-ylmethanone |
| SMILES | O=C(C1CCC=CCCC1)N1CCCC1c1nc(C2CCCCCCCC2)no1 |
| InChI | InChI=1S/C24H37N3O2/c28-24(20-15-10-6-3-7-11-16-20)27-18-12-17-21(27)23-25-22(26-29-23)19-13-8-4-1-2-5-9-14-19/h3,6,19-21H,1-2,4-5,7-18H2 |
| InChIKey | PHPQYOISVARQPH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|