About 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane
4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane (PubChem CID 123339090) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane.
Molecular Properties
| Compound Name | 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane |
| PubChem CID | 123339090 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane |
| SMILES | C=C1SCCC(C)N1C(C)C |
| InChI | InChI=1S/C9H17NS/c1-7(2)10-8(3)5-6-11-9(10)4/h7-8H,4-6H2,1-3H3 |
| InChIKey | VFZXHXLHENDJAS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane?
The IUPAC name of 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane (CID 123339090) is 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane.
What is the SMILES notation for 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane?
The canonical SMILES for 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane is C=C1SCCC(C)N1C(C)C.
What is the InChIKey of 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane?
The InChIKey is VFZXHXLHENDJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS/c1-7(2)10-8(3)5-6-11-9(10)4/h7-8H,4-6H2,1-3H3.
What are the key properties of 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane?
4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane has a molecular weight of 171.31 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-methylidene-3-propan-2-yl-1,3-thiazinane is sourced from PubChem (CID 123339090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).